|
CAS#: 99300-58-0 Product: 4-(6-Nitro-4H-1,3,2-Benzodioxaphosphorin-2-Yl)Morpholine 4-Sulfide No suppilers available for the product. |
| Name | 4-(6-Nitro-4H-1,3,2-Benzodioxaphosphorin-2-Yl)Morpholine 4-Sulfide |
|---|---|
| Synonyms | 4-(3-Nitro-8-Thioxo-7,9-Dioxa-8$L^{5}-Phosphabicyclo[4.4.0]Deca-1(6),2,4-Trien-8-Yl)Morpholine; Morpholine, 4-(6-Nitro-4H-1,3,2-Benzodioxaphosphorin-2-Yl)-, P-Sulfide; 4-(6-Nitro-4H-1,3,2-Benzodioxaphosphorin-2-Yl)Morpholine P-Sulfide |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13N2O5PS |
| Molecular Weight | 316.27 |
| CAS Registry Number | 99300-58-0 |
| SMILES | C1=C2C(=CC=C1[N+]([O-])=O)O[P](=S)(OC2)N3CCOCC3 |
| InChI | 1S/C11H13N2O5PS/c14-13(15)10-1-2-11-9(7-10)8-17-19(20,18-11)12-3-5-16-6-4-12/h1-2,7H,3-6,8H2 |
| InChIKey | MRIOYEWIJKSFMC-UHFFFAOYSA-N |
| Density | 1.542g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.009°C at 760 mmHg (Cal.) |
| Flash point | 228.981°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(6-Nitro-4H-1,3,2-Benzodioxaphosphorin-2-Yl)Morpholine 4-Sulfide |