|
CAS#: 99345-83-2 Product: Tris(2,4,4-Trimethylpentyl)Phosphine Oxide No suppilers available for the product. |
| Name | Tris(2,4,4-Trimethylpentyl)Phosphine Oxide |
|---|---|
| Synonyms | 1-[Bis(2,4,4-Trimethylpentyl)Phosphoryl]-2,4,4-Trimethyl-Pentane; Phosphine Oxide, Tris(2,4,4-Trimethylpentyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C24H51OP |
| Molecular Weight | 386.64 |
| CAS Registry Number | 99345-83-2 |
| SMILES | C([P](=O)(CC(CC(C)(C)C)C)CC(CC(C)(C)C)C)C(CC(C)(C)C)C |
| InChI | 1S/C24H51OP/c1-19(13-22(4,5)6)16-26(25,17-20(2)14-23(7,8)9)18-21(3)15-24(10,11)12/h19-21H,13-18H2,1-12H3 |
| InChIKey | WWYUQXYAGXKBNE-UHFFFAOYSA-N |
| Density | 0.859g/cm3 (Cal.) |
|---|---|
| Boiling point | 473.433°C at 760 mmHg (Cal.) |
| Flash point | 240.124°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tris(2,4,4-Trimethylpentyl)Phosphine Oxide |