|
CAS#: 99479-46-6 Product: 5-Amino-1-(4-chloro-2-ethoxy-6-fluorophenyl)-1H-pyrazole-3-carbonitrile No suppilers available for the product. |
| Name | 5-Amino-1-(4-chloro-2-ethoxy-6-fluorophenyl)-1H-pyrazole-3-carbonitrile |
|---|---|
| Synonyms | 5-Amino-1 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10ClFN4O |
| Molecular Weight | 280.69 |
| CAS Registry Number | 99479-46-6 |
| SMILES | CCOC1=C(C(=CC(=C1)Cl)F)N2C(=CC(=N2)C#N)N |
| InChI | 1S/C12H10ClFN4O/c1-2-19-10-4-7(13)3-9(14)12(10)18-11(16)5-8(6-15)17-18/h3-5H,2,16H2,1H3 |
| InChIKey | CTQPDXMFNFZHQS-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 463.0±45.0°C at 760 mmHg (Cal.) |
| Flash point | 233.8±28.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Amino-1-(4-chloro-2-ethoxy-6-fluorophenyl)-1H-pyrazole-3-carbonitrile |