|
CAS#: 996-67-8 Product: Bromodinitromethane No suppilers available for the product. |
| Name | Bromodinitromethane |
|---|---|
| Synonyms | Bromo-Dinitro-Methane; Brn 1705376; Bromodinitromethane |
| Molecular Structure | ![]() |
| Molecular Formula | CHBrN2O4 |
| Molecular Weight | 184.93 |
| CAS Registry Number | 996-67-8 |
| SMILES | O=[N+](C(Br)[N+]([O-])=O)[O-] |
| InChI | 1S/CHBrN2O4/c2-1(3(5)6)4(7)8/h1H |
| InChIKey | GJPMCGKOSHNWNL-UHFFFAOYSA-N |
| Density | 2.197g/cm3 (Cal.) |
|---|---|
| Boiling point | 159.043°C at 760 mmHg (Cal.) |
| Flash point | 49.988°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bromodinitromethane |