Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054//+86 13424336463 | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-Methyl-1-(4-nitrophenyl)thiourea |
|---|---|
| Synonyms | 1-methyl-1-(4-nitrophenyl)thiourea |
| Molecular Structure |  |
| Molecular Formula | C8H9N3O2S |
| Molecular Weight | 211.24 |
| CAS Registry Number | 99700-94-4 |
| SMILES | CN(c1ccc(cc1)[N+](=O)[O-])C(=S)N |
| InChI | 1S/C8H9N3O2S/c1-10(8(9)14)6-2-4-7(5-3-6)11(12)13/h2-5H,1H3,(H2,9,14) |
| InChIKey | YQVKBBZBJMYNOT-UHFFFAOYSA-N |
| Density | 1.428g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.206°C at 760 mmHg (Cal.) |
| Flash point | 183.137°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-1-(4-nitrophenyl)thiourea |