|
CAS#: 99849-00-0 Product: 1,5-Dichloro-2,3,4-Trimethoxybenzene No suppilers available for the product. |
| Name | 1,5-Dichloro-2,3,4-Trimethoxybenzene |
|---|---|
| Synonyms | 1,5-Dichloro-2,3,4-Trimethoxy-Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10Cl2O3 |
| Molecular Weight | 237.08 |
| CAS Registry Number | 99849-00-0 |
| SMILES | C1=C(Cl)C(=C(C(=C1Cl)OC)OC)OC |
| InChI | 1S/C9H10Cl2O3/c1-12-7-5(10)4-6(11)8(13-2)9(7)14-3/h4H,1-3H3 |
| InChIKey | YKVPBSSGUIMWMU-UHFFFAOYSA-N |
| Density | 1.279g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.821°C at 760 mmHg (Cal.) |
| Flash point | 105.133°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,5-Dichloro-2,3,4-Trimethoxybenzene |