|
CAS#: 99948-80-8 Product: 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium phosphate No suppilers available for the product. |
| Name | 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium phosphate |
|---|---|
| Synonyms | 1-(3,4-di |
| Molecular Structure | ![]() |
| Molecular Formula | C20H24NO8P |
| Molecular Weight | 437.38 |
| CAS Registry Number | 99948-80-8 |
| EINECS | 309-088-8 |
| SMILES | [O-]P([O-])([O-])=O.COc1ccc(cc1OC)CC2=[NH+]CCc3cc(OC)c(OC)cc23 |
| InChI | 1S/C20H23NO4.H3O4P/c1-22-17-6-5-13(10-18(17)23-2)9-16-15-12-20(25-4)19(24-3)11-14(15)7-8-21-16;1-5(2,3)4/h5-6,10-12H,7-9H2,1-4H3;(H3,1,2,3,4)/p-2 |
| InChIKey | AUHDGLOATXLEDD-UHFFFAOYSA-L |
| Boiling point | 666.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 357.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium phosphate |