|
CAS#: 99957-90-1 Product: 19-(Ethyldithio)Androst-4-Ene-3,17-Dione No suppilers available for the product. |
| Name | 19-(Ethyldithio)Androst-4-Ene-3,17-Dione |
|---|---|
| Synonyms | (8S,9S,10S,13S,14S)-10-(Ethyldisulfanylmethyl)-13-Methyl-2,6,7,8,9,11,12,14,15,16-Decahydro-1H-Cyclopenta[A]Phenanthrene-3,17-Quinone; 19-(Ethyldithio)Androst-4-Ene-3,17-Dione; Androst-4-Ene-3,17-Dione, 19-(Ethyldithio)- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H30O2S2 |
| Molecular Weight | 378.59 |
| CAS Registry Number | 99957-90-1 |
| SMILES | [C@H]13[C@@H](CCC2=CC(CC[C@]12CSSCC)=O)[C@H]4[C@](CC3)(C(CC4)=O)C |
| InChI | 1S/C21H30O2S2/c1-3-24-25-13-21-11-8-15(22)12-14(21)4-5-16-17-6-7-19(23)20(17,2)10-9-18(16)21/h12,16-18H,3-11,13H2,1-2H3/t16-,17-,18-,20-,21+/m0/s1 |
| InChIKey | RCEOCOMZMSAAFR-OAGDOXAWSA-N |
| Density | 1.198g/cm3 (Cal.) |
|---|---|
| Boiling point | 532.125°C at 760 mmHg (Cal.) |
| Flash point | 220.899°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 19-(Ethyldithio)Androst-4-Ene-3,17-Dione |