| PepTech Corporation | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (781) 273-5400 | |||
![]() |
service@peptechcorp.com | |||
| Chemical manufacturer | ||||
| Name | trans-1-Boc-4-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| Synonyms | Boc-trans-DL-beta-Pro-4-(4-methoxyphenyl)-OH |
| Molecular Structure | ![]() |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 |
| CAS Registry Number | 1000415-75-7 |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@H](C1)C(=O)O)C2=CC=C(C=C2)OC |
| Density | 1.2±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.541, Calc.* |
| Boiling Point | 474.6±45.0 ºC (760 mmHg), Calc.* |
| Flash Point | 240.8±28.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P261-P264-P270-P271-P280-P3022+P352-P304+P340 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for trans-1-Boc-4-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid |