| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Natural product >> Phenylpropanoid |
|---|---|
| Name | 2,3-Dihydroxy-3-(4-hydroxyphenyl)propanoic acid |
| Synonyms | 3-(p-Hydroxyphenyl)-2,3-dihydroxypropionic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10O5 |
| Molecular Weight | 198.18 |
| CAS Registry Number | 100201-57-8 |
| EC Number | 959-447-3 |
| SMILES | C1=CC(=CC=C1C(C(C(=O)O)O)O)O |
| Density | 1.5±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.654, Calc.* |
| Boiling Point | 489.8±45.0 ºC (760 mmHg), Calc.* |
| Flash Point | 264.1±25.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H315-H319-H335 Details | ||||||||||||||||||||
| Precautionary Statements | P261-P264-P264+P265-P271-P280-P302+P352-P304+P340-P305+P351+P338-P319-P321-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||
| |||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydroxy-3-(4-hydroxyphenyl)propanoic acid |