| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Natural product >> Alkaloid |
|---|---|
| Name | Picrasidine I |
| Synonyms | 1-ethenyl-4-methoxy-9H-pyrido[3,4-b]indol-8-ol |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 |
| CAS Registry Number | 100234-59-1 |
| SMILES | COC1=CN=C(C2=C1C3=C(N2)C(=CC=C3)O)C=C |
| Solubility | 38.52 mg/L (25 ºC water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.772, Calc.* |
| Melting point | 178.24 ºC |
| Boiling Point | 528.2±45.0 ºC (760 mmHg), Calc.*, 426.45 ºC |
| Flash Point | 273.3±28.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P261-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Picrasidine I |