| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Analytical chemistry >> Analytical reagent >> Ion chromatography reagent |
|---|---|
| Name | Norfloxacin-d5 |
| Synonyms | 6-fluoro-4-oxo-1-(1,1,2,2,2-pentadeuterioethyl)-7-piperazin-1-ylquinoline-3-carboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18FN3O3 |
| Molecular Weight | 319.33 |
| CAS Registry Number | 1015856-57-1 |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N1C=C(C(=O)C2=CC(=C(C=C21)N3CCNCC3)F)C(=O)O |
| Density | 1.3±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.595, Calc.* |
| Boiling Point | 555.8±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 289.9±30.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H319 Details |
| Precautionary Statements | P280-P305+P351+P338-P337+P313 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Norfloxacin-d5 |