|
CAS: 103-40-2 Product: Succinic acid monobenzyl ester No suppilers available. |
| Name | Succinic acid monobenzyl ester |
|---|---|
| Synonyms | 4-Oxo-4Phenylmethoxybutanoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 |
| CAS Registry Number | 103-40-2 |
| EC Number | 203-108-8 |
| SMILES | C1=CC=C(C=C1)COC(=O)CCC(=O)O |
| Solubility | 2717 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.537, Calc.* |
| Melting point | 106.75 ºC |
| Boiling Point | 341.42 ºC, 368.5±25.0 ºC (760 mmHg), Calc.* |
| Flash Point | 144.5±16.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H315-H319-H335 Details |
| Precautionary Statements | P261-P264-P264+P265-P271-P280-P302+P352-P304+P340-P305+P351+P338-P319-P321-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Succinic acid monobenzyl ester |