| Bakul APIs | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (22) 6169-7900 | |||
![]() |
sales@bakulpharma.com | |||
| Chemical manufacturer since 1997 | ||||
| chemBlink standard supplier since 2022 | ||||
| Name | 8-Bromotheophylline |
|---|---|
| Synonyms | 8-Bromo-1,3-dimethyl-7H-purine-2,6-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C7H7BrN4O2 |
| Molecular Weight | 259.06 |
| CAS Registry Number | 10381-75-6 |
| EC Number | 233-846-6 |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)NC(=N2)Br |
| Solubility | 7892 mg/L (25 ºC water) |
|---|---|
| Density | 1.9±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.652, Calc.* |
| Melting point | 207.62 ºC |
| Boiling Point | 489.34 ºC, 469.5±55.0 ºC (760 mmHg), Calc.* |
| Flash Point | 237.7±31.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302-H315-H319-H335 Details | ||||||||||||||||||||||||
| Precautionary Statements | P261-P264-P264+P265-P270-P271-P280-P301+P317-P302+P352-P304+P340-P305+P351+P338-P319-P321-P330-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||
| |||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 8-Bromotheophylline |