| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Montelukast Cyclized Ether impurity |
|---|---|
| Synonyms | (E)-Montelukast Ether Impurity;7-chloro-2-[(E)-2-[3-(1,1-dimethyl-4,5-dihydro-3H-2-benzoxepin-3-yl)phenyl]ethenyl]quinoline |
| Molecular Structure | ![]() |
| Molecular Formula | C29H26ClNO |
| Molecular Weight | 439.98 |
| CAS Registry Number | 1040351-42-5 |
| EC Number | 691-151-7 |
| SMILES | CC1(C2=CC=CC=C2CCC(O1)C3=CC=CC(=C3)/C=C/C4=NC5=C(C=CC(=C5)Cl)C=C4)C |
| Density | 1.2±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.660, Calc.* |
| Boiling Point | 595.0±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 313.7±30.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H312-H332 Details |
| Precautionary Statements | P261-P264-P270-P271-P280-P301+P317-P302+P352-P304+P340-P317-P321-P330-P362+P364-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Montelukast Cyclized Ether impurity |