|
Online Database of Chemicals from Around the World
|
Search |
Submit |
中文
|
|
|
Home
>>
Chemical Listing
>>
D >> 1,1-Dimethylethyl 6-formyl-2,2-dimethyl-1,3-dioxane-4-acetate
|
|
|
|
1,1-Dimethylethyl 6-formyl-2,2-dimethyl-1,3-dioxane-4-acetate [1044518-75-3]
|
|
|
|
Identification |
Name |
|
1,1-Dimethylethyl 6-formyl-2,2-dimethyl-1,3-dioxane-4-acetate |
|
Molecular Structure |
|
 |
|
Molecular Weight |
|
258.31 |
CAS Registry Number |
|
1044518-75-3 |
SMILES |
|
CC1(OC(CC(O1)C=O)CC(=O)OC(C)(C)C)C |
|
Properties |
|
Solubility |
|
409.9 mg/L (25 ºC water) |
Density |
|
1.1±0.1 g/cm3, Calc.* |
Index of Refraction |
|
1.470, Calc.* |
Melting point |
|
89.42 ºC |
Boiling Point |
|
316.66 ºC, 320.3±32.0 ºC (760 mmHg), Calc.* |
Flash Point |
|
140.6±13.1 ºC, Calc.* |
|
|
|
*
|
Calculated using Advanced Chemistry Development (ACD/Labs) Software.
|
|
|
|
|
Market Analysis Reports |
|
|
|
|
|
|
|
|