| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Omeprazole Impurity 16 |
|---|---|
| Synonyms | 5-methoxy-1H-benzimidazole-2-sulfonic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8N2O4S |
| Molecular Weight | 228.23 |
| CAS Registry Number | 106135-28-8 |
| SMILES | COC1=CC2=C(C=C1)N=C(N2)S(=O)(=O)O |
| Solubility | 1 mg/L (25 ºC water) |
|---|---|
| Density | 1.6±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.666, Calc.* |
| Melting point | 208.63 ºC |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302+H312+H332-H315-H319 Details |
| Precautionary Statements | P261-P271-P280-P302+P352-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Omeprazole Impurity 16 |