| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N-(2-{3-Hydroxy-7-[(2H3)methyloxy]-1-naphthyl}ethyl)acetamide |
|---|---|
| Synonyms | 3-Hydroxy agomelatine D3 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14D3NO3 |
| Molecular Weight | 262.32 |
| CAS Registry Number | 1079774-23-4 |
| SMILES | CC(NCCC1=C2C=C(OC([2H])([2H])[2H])C=CC2=CC(O)=C1)=O |
| Density | 1.2±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.606, Calc.* |
| Boiling Point | 545.8±40.0 ºC (760 mmHg), Calc.* |
| Flash Point | 283.9±27.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-(2-{3-Hydroxy-7-[(2H3)methyloxy]-1-naphthyl}ethyl)acetamide |