| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | (3S)-3-({[(3S)-3-(Aminomethyl)-5-methylhexanoyl]amino}methyl)-5-methylhexanoic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H32N2O3 |
| Molecular Weight | 300.44 |
| CAS Registry Number | 1083246-65-4 |
| SMILES | CC(C)C[C@@H](CC(=O)NC[C@@H](CC(C)C)CC(=O)O)CN |
| Density | 1.0±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.480, Calc.* |
| Boiling Point | 498.6±30.0 ºC (760 mmHg), Calc.* |
| Flash Point | 255.3±24.6 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for (3S)-3-({[(3S)-3-(Aminomethyl)-5-methylhexanoyl]amino}methyl)-5-methylhexanoic acid |