| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Biochemical >> Nucleoside drugs >> Nucleotides and their analogues |
|---|---|
| Name | 2-O-DMT-sulfonyldiethanol phosphoramidite |
| Synonyms | 3-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethylsulfonyl]ethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| Molecular Structure | ![]() |
| Molecular Formula | C34H45N2O7PS |
| Molecular Weight | 656.77 |
| CAS Registry Number | 108783-02-4 |
| EC Number | 853-148-0 |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OCCS(=O)(=O)CCOC(C1=CC=CC=C1)(C2=CC=C(C=C2)OC)C3=CC=C(C=C3)OC |
| Boiling Point | 717.4±60.0 ºC (760 mmHg), Calc.* |
|---|---|
| Flash Point | 387.7±32.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302-H315-H319 Details | ||||||||||||
| Precautionary Statements | P264-P270-P280-P305+P351+P338-P330-P362+P364-P501 Details | ||||||||||||
| Hazard Classification | |||||||||||||
| |||||||||||||
| SDS | Available | ||||||||||||
| Market Analysis Reports |
| List of Reports Available for 2-O-DMT-sulfonyldiethanol phosphoramidite |