| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Hydroxy bendamustine |
|---|---|
| Synonyms | 4-[5-[2-chloroethyl(2-hydroxyethyl)amino]-1-methylbenzimidazol-2-yl]butanoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C16H22ClN3O3 |
| Molecular Weight | 339.82 |
| CAS Registry Number | 109882-27-1 |
| EC Number | 807-636-5 |
| SMILES | CN1C2=C(C=C(C=C2)N(CCO)CCCl)N=C1CCCC(=O)O |
| Solubility | 126.1 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.602, Calc.* |
| Melting point | 238.44 ºC |
| Boiling Point | 555.33 ºC, 608.5±55.0 ºC (760 mmHg), Calc.* |
| Flash Point | 321.8±31.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H301-H341-H351-H360 Details | ||||||||||||||||||||||||||||
| Precautionary Statements | P203-P260-P264-P270-P280-P281-P301+P316-P318-P319-P321-P330-P405-P501 Details | ||||||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for Hydroxy bendamustine |