|
CAS: 1099592-35-4 Product: Hnash No suppilers available. |
| Name | Hnash |
|---|---|
| Synonyms | 2-hydroxy-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]benzamide |
| Molecular Structure | ![]() |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 |
| CAS Registry Number | 1099592-35-4 |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2/C=N/NC(=O)C3=CC=CC=C3O)O |
| Solubility | 6.229 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.647, Calc.* |
| Melting point | 234.77 ºC |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Hnash |