| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2-Methyl-2'-deoxyadenosine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H15N5O3 |
| Molecular Weight | 265.27 |
| CAS Registry Number | 110952-90-4 |
| SMILES | CC1=NC(=C2C(=N1)N(C=N2)[C@H]3C[C@@H]([C@H](O3)CO)O)N |
| Solubility | 1317 mg/L (25 ºC water) |
|---|---|
| Density | 1.8±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.819, Calc.* |
| Melting point | 218.48 ºC |
| Boiling Point | 512.59 ºC, 476.2±55.0 ºC (760 mmHg), Calc.* |
| Flash Point | 241.8±31.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2'-deoxyadenosine |