| Wuxi LabNetwork | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (27) 5076-6799 | |||
![]() |
vicky_zhu@labnetwork.com | |||
| Chemical manufacturer since 2015 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | (Bromoethynyl)triisopropylsilane |
|---|---|
| Synonyms | 2-bromoethynyl-tri(propan-2-yl)silane |
| Molecular Structure | ![]() |
| Molecular Formula | C11H21BrSi |
| Molecular Weight | 261.27 |
| CAS Registry Number | 111409-79-1 |
| EC Number | 836-090-0 |
| SMILES | CC(C)[Si](C#CBr)(C(C)C)C(C)C |
| Solubility | 0.3626 mg/L (25 ºC water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.465, Calc.* |
| Melting point | 35.87 ºC |
| Boiling Point | 227.42 ºC, 240.5±9.0 ºC (760 mmHg), Calc.* |
| Flash Point | 137.4±13.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H314-H315-H319-H335 Details | ||||||||||||||||||||||||
| Precautionary Statements | P260-P261-P264-P264+P265-P271-P280-P301+P330+P331-P302+P352-P302+P361+P354-P304+P340-P305+P351+P338-P305+P354+P338-P316-P319-P321-P332+P317-P337+P317-P362+P364-P363-P403+P233-P405-P501 Details | ||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||
| |||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for (Bromoethynyl)triisopropylsilane |