Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4-Tert-butylbenzenesulfonic acid |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C10H14O3S |
| Molecular Weight | 214.28 |
| CAS Registry Number | 1133-17-1 |
| SMILES | CC(C)(C)C1=CC=C(C=C1)S(=O)(=O)O |
| Solubility | 8535 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.534, Calc.* |
| Melting point | 115.81 ºC |
| Boiling Point | 355.50 ºC |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 4-Tert-butylbenzenesulfonic acid |