Online Database of Chemicals from Around the World
| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (551) 6288-8437 +86 18096409024 | |||
 |
info@purerechem.com | |||
 |
Skype Chat | |||
 |
QQ chat | |||
 |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Olopatadine Methyl Ester |
|---|---|
| Synonyms | 11-[(Z)-3-(Dimethylamino)propylidene]-6,11-dihydrodibenzo[b,e]oxepin-2-acetic acid methyl ester |
| Molecular Structure | ![CAS # 113806-01-2, Olopatadine Methyl Ester, 11-[(Z)-3-(Dimethylamino)propylidene]-6,11-dihydrodibenzo[b,e]oxepin-2-acetic acid methyl ester](/structures/113806-01-2.gif) |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.44 |
| CAS Registry Number | 113806-01-2 |
| SMILES | CN(C)CC/C=C\1/C2=CC=CC=C2COC3=C1C=C(C=C3)CC(=O)OC |
| Solubility | 1.577 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.609, Calc.* |
| Melting point | 175.06 ºC |
| Boiling Point | 445.75 ºC, 487.6±45.0 ºC (760 mmHg), Calc.* |
| Flash Point | 248.7±28.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Olopatadine Methyl Ester |