| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Homoalanosine |
|---|---|
| Synonyms | (Z)-[(3S)-3-amino-3-carboxypropyl]-hydroxyimino-oxidoazanium |
| Molecular Structure | ![]() |
| Molecular Formula | C4H9N3O4 |
| Molecular Weight | 163.13 |
| CAS Registry Number | 114707-36-7 |
| SMILES | C(C/[N+](=N/O)/[O-])[C@@H](C(=O)O)N |
| Solubility | 1 mg/L (25 ºC water) |
|---|---|
| Density | 1.7±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.593, Calc.* |
| Melting point | 301.18 ºC |
| Boiling Point | 460.49 ºC, 385.1±52.0 ºC (760 mmHg), Calc.* |
| Flash Point | 186.7±30.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Homoalanosine |