| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Analytical chemistry >> Standard >> Analytical standard |
|---|---|
| Name | Mebendazole-d3 |
| Synonyms | trideuteriomethyl N-(6-benzoyl-1H-benzimidazol-2-yl)carbamate |
| Molecular Structure | ![]() |
| Molecular Formula | C16H13N3O3 |
| Molecular Weight | 298.31 |
| CAS Registry Number | 1173021-87-8 |
| EC Number | 688-537-2 |
| SMILES | [2H]C([2H])([2H])OC(=O)NC1=NC2=C(N1)C=C(C=C2)C(=O)C3=CC=CC=C3 |
| Density | 1.4±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.703, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Classification | |||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| |||||||||||||
| SDS | Available | ||||||||||||
| Market Analysis Reports |
| List of Reports Available for Mebendazole-d3 |