| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2-Amino-2-(2,4-dichlorophenyl)ethanol |
|---|---|
| Molecular Structure | ![]() |
| Protein Sequence | X |
| Molecular Formula | C8H9Cl2NO |
| Molecular Weight | 206.07 |
| CAS Registry Number | 1184839-78-8 |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(CO)N |
| Density | 1.4±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.600, Calc.* |
| Boiling Point | 354.1±37.0 ºC (760 mmHg), Calc.* |
| Flash Point | 167.9±26.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H332-H335 Details |
| Precautionary Statements | P280-P305+P351+P338-P310 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-2-(2,4-dichlorophenyl)ethanol |