| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Analytical chemistry >> Standard >> Forensic and veterinary standards |
|---|---|
| Name | Oxolinic Acid-d5 |
| Synonyms | 8-Oxo-5-(1,1,2,2,2-pentadeuterioethyl)-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C13H11NO5 |
| Molecular Weight | 266.26 |
| CAS Registry Number | 1189890-98-9 |
| EC Number | 802-669-1 |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N1C=C(C(=O)C2=CC3=C(C=C21)OCO3)C(=O)O |
| Melting point | 320-321 ºC |
|---|---|
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302 Details |
| Precautionary Statements | P264-P270-P301+P312-P330-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Oxolinic Acid-d5 |