| RR Scientific LLC | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (139) 1774-3231 | |||
![]() |
erica.l@rrscientific.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink standard supplier since 2022 | ||||
| Name | (S)-4-Oxo-4,6,7,8-tetrahydropyrrolo[1,2-a]pyrimidine-6-carboxylic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16 |
| CAS Registry Number | 1190392-22-3 |
| SMILES | C1CC2=NC=CC(=O)N2[C@@H]1C(=O)O |
| Density | 1.6±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.715, Calc.* |
| Boiling Point | 392.2±44.0 ºC (760 mmHg), Calc.* |
| Flash Point | 191.0±28.4 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H312-H332 Details |
| Precautionary Statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P330-P363-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for (S)-4-Oxo-4,6,7,8-tetrahydropyrrolo[1,2-a]pyrimidine-6-carboxylic acid |