Online Database of Chemicals from Around the World
| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (551) 6288-8437 +86 18096409024 | |||
 |
info@purerechem.com | |||
 |
Skype Chat | |||
 |
QQ chat | |||
 |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Levomedetomidine |
|---|---|
| Synonyms | 5-[(1R)-1-(2,3-dimethylphenyl)ethyl]-1H-imidazole |
| Molecular Structure | ![CAS # 119717-21-4, Levomedetomidine, 5-[(1R)-1-(2,3-dimethylphenyl)ethyl]-1H-imidazole](/structures/119717-21-4.gif) |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 |
| CAS Registry Number | 119717-21-4 |
| SMILES | CC1=C(C(=CC=C1)[C@@H](C)C2=CN=CN2)C |
| Solubility | 23.56 mg/L (25 ºC water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.570, Calc.* |
| Melting point | 132.01 ºC |
| Boiling Point | 386.32 ºC, 381.9±11.0 ºC (760 mmHg), Calc.* |
| Flash Point | 191.3±5.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Levomedetomidine |