| E-fine Bio Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 15251778053 | |||
![]() |
William.efine@hotmail.com | |||
| Chemical manufacturer since 2021 | ||||
| chemBlink standard supplier since 2022 | ||||
| Name | Ibrexafungerp |
|---|---|
| Synonyms | (1R,5S,6R,7R,10R,11R,14R,15S,20R,21R)-21-[(2R)-2-amino-2,3,3-trimethylbutoxy]-5,7,10,15-tetramethyl-7-[(2R)-3-methylbutan-2-yl]-20-(5-pyridin-4-yl-1,2,4-triazol-1-yl)-17-oxapentacyclo[13.3.3.01,14.02,11.05,10]henicos-2-ene-6-carboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C44H67N5O4 |
| Molecular Weight | 730.03 |
| CAS Registry Number | 1207753-03-4 |
| SMILES | C[C@H](C(C)C)[C@]1(CC[C@@]2([C@H]3CC[C@H]4[C@]5(COC[C@]4(C3=CC[C@]2([C@@H]1C(=O)O)C)C[C@H]([C@@H]5OC[C@@](C)(C(C)(C)C)N)N6C(=NC=N6)C7=CC=NC=C7)C)C)C |
| Density | 1.2±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.617, Calc.* |
| Boiling Point | 815.9±75.0 ºC (760 mmHg), Calc.* |
| Flash Point | 447.2±37.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Ibrexafungerp |