| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Propoxur D3 (N-methyl D3) |
|---|---|
| Synonyms | (2-propan-2-yloxyphenyl) N-(trideuteriomethyl)carbamate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 212.26 |
| CAS Registry Number | 1219798-56-7 |
| SMILES | [2H]C([2H])([2H])NC(=O)OC1=CC=CC=C1OC(C)C |
| Density | 1.1±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.503, Calc.* |
| Boiling Point | 295.4±32.0 ºC (760 mmHg), Calc.* |
| Flash Point | 132.5±25.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Propoxur D3 (N-methyl D3) |