Online Database of Chemicals from Around the World
(6Z,9Z,28Z,31Z)-Heptatriaconta-6,9,28,31-tetraen-19-yl 4-(dimethylamino)butanoate
[CAS# 1224606-06-7]
Identification
| Name |
(6Z,9Z,28Z,31Z)-Heptatriaconta-6,9,28,31-tetraen-19-yl 4-(dimethylamino)butanoate |
|
| Molecular Structure |
 |
| Molecular Formula |
C43H79NO2 |
| Molecular Weight |
642.09 |
| CAS Registry Number |
1224606-06-7 |
| SMILES |
CCCCC/C=C\C/C=C\CCCCCCCCC(OC(=O)CCCN(C)C)CCCCCCCC/C=C\C/C=C\CCCCC |
|
Properties
| Density |
0.9±0.1 g/cm3, Calc.* |
| Index of Refraction |
1.484, Calc.* |
| Boiling Point |
670.2±43.0 ºC (760 mmHg), Calc.* |
| Flash Point |
84.6±19.0 ºC, Calc.* |
|
|
*
|
Calculated using Advanced Chemistry Development (ACD/Labs) Software.
|
|
Safety Data
|
Hazard Symbols |
GHS07 Warning Details |
|
Hazard Statements |
H302-H315-H319-H335 Details |
|
Precautionary Statements |
P261-P280-P301+P312-P302+P352-P305+P351+P338 Details |
|
SDS |
Available |
|
Related Products
4-Heptanone 2-Heptanone 3-Heptanone Heptanoyl chloride 2,5,8,11,14,17,20-Heptaoxadocosan-22-amine 2,5,8,11,14,17,20-Heptaoxadocosane-22-thiol 4,7,10,13,16,19,22-Heptaoxapentacosanedioic acid 4,7,10,13,16,19,22-Heptaoxapentacos-24-ynoic acid 1,1-dimethylethyl ester 3,6,9,12,15,18,21-Heptaoxatricosane-1,23-diamine 4,7,10,13,16,19,22-Heptaoxatricosanoic acid (+)-Heptelidic acid (Z)-4-Heptenal trans-2-Heptenal 4-Heptenal 3-Heptene 2-Heptene Hept-1-ene Heptanal polymer with benzenamine 4-Heptanamine Heptanamine benzoate