| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Analytical chemistry >> Standard >> Forensic and veterinary standards |
|---|---|
| Name | Pefloxacin-d5 |
| Synonyms | 6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxo-1-(1,1,2,2,2-pentadeuterioethyl)quinoline-3-carboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C17H15D5FN3O3 |
| Molecular Weight | 338.39 |
| CAS Registry Number | 1228182-51-1 |
| EC Number | 688-171-3 |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N1C=C(C(=O)C2=CC(=C(C=C21)N3CCN(CC3)C)F)C(=O)O |
| Density | 1.3±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.594, Calc.* |
| Boiling Point | 529.1±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 273.8±30.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302 Details | ||||||||||||
| Precautionary Statements | P264-P270-P301+P312-P330-P501 Details | ||||||||||||
| Hazard Classification | |||||||||||||
| |||||||||||||
| SDS | Available | ||||||||||||
| Market Analysis Reports |
| List of Reports Available for Pefloxacin-d5 |