| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | (R)-1,1'-binaphthyl-2,2'-disulfonamide |
|---|---|
| Synonyms | 1-(2-sulfamoylnaphthalen-1-yl)naphthalene-2-sulfonamide |
| Molecular Structure | ![]() |
| Molecular Formula | C20H16N2O4S2 |
| Molecular Weight | 412.48 |
| CAS Registry Number | 1245748-66-6 |
| EC Number | 806-146-9 |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)S(=O)(=O)N)S(=O)(=O)N |
| Density | 1.5±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.744, Calc.* |
| Boiling Point | 712.1±43.0 ºC (760 mmHg), Calc.* |
| Flash Point | 384.5±28.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H319 Details | ||||||||||||
| Precautionary Statements | P264-P280-P305+P351+P338-P337+P313 Details | ||||||||||||
| Hazard Classification | |||||||||||||
| |||||||||||||
| SDS | Available | ||||||||||||
| Market Analysis Reports |
| List of Reports Available for (R)-1,1'-binaphthyl-2,2'-disulfonamide |