| Yaopu (Shanghai) Pharma Tech Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (021) 5092-9289 | |||
![]() |
sales@ypptech.com.cn | |||
![]() |
QQ chat | |||
![]() |
WeChat: 13764387674 | |||
| Chemical manufacturer since 2007 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | (S)-4-(3-((tert-Butoxycarbonyl)amino)-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl)benzyl 2,4-dimethylbenzoate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C33H35N3O5 |
| Molecular Weight | 553.65 |
| CAS Registry Number | 1253955-19-9 |
| SMILES | CC1=CC(=C(C=C1)C(=O)OCC2=CC=C(C=C2)[C@@H](CNC(=O)OC(C)(C)C)C(=O)NC3=CC4=C(C=C3)C=NC=C4)C |
| Density | 1.2±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.623, Calc.* |
| Boiling Point | 780.8±60.0 ºC (760 mmHg), Calc.* |
| Flash Point | 426.0±32.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for (S)-4-(3-((tert-Butoxycarbonyl)amino)-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl)benzyl 2,4-dimethylbenzoate |