| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N-(2,4-dimethylphenyl)-N'-(trideuteriomethyl)methanimidamide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 165.25 |
| CAS Registry Number | 1255517-75-9 |
| SMILES | [2H]C([2H])([2H])N=CNC1=C(C=C(C=C1)C)C |
| Density | 0.9±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.513, Calc.* |
| Boiling Point | 245.9±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 102.5±30.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for N-(2,4-dimethylphenyl)-N'-(trideuteriomethyl)methanimidamide |