| Shanghai Worldyang Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13651600618 +86 (21) 5679-5779 | |||
![]() |
sales7777@worldyachem.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: 13651600618 | |||
![]() |
WhatsApp: +86 13651600618 | |||
| Chemical manufacturer since 2012 | ||||
| chemBlink premium supplier since 2023 | ||||
| Name | 3-Chloro-7,8-dihydroquinolin-5(6H)-one |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C9H8ClNO |
| Molecular Weight | 181.62 |
| CAS Registry Number | 127724-75-8 |
| SMILES | C1CC2=C(C=C(C=N2)Cl)C(=O)C1 |
| Solubility | 949.5 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.584, Calc.* |
| Melting point | 80.40 ºC |
| Boiling Point | 288.14 ºC, 298.4±40.0 ºC (760 mmHg), Calc.* |
| Flash Point | 134.2±27.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P261-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-7,8-dihydroquinolin-5(6H)-one |