| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Decinnamoyltaxagifine |
|---|---|
| Synonyms | (3,4,11-triacetyloxy-2,8-dihydroxy-1,5,15-trimethyl-9-methylidene-14-oxo-16-oxatetracyclo[10.5.0.02,15.05,10]heptadecan-6-yl) acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C28H38O12 |
| Molecular Weight | 566.59 |
| CAS Registry Number | 130394-69-3 |
| SMILES | CC(=O)OC1CC(C(=C)C2C1(C(C(C3(C4(COC3(C(=O)CC4C2OC(=O)C)C)C)O)OC(=O)C)OC(=O)C)C)O |
| Density | 1.3±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.555, Calc.* |
| Boiling Point | 635.4±55.0 ºC (760 mmHg), Calc.* |
| Flash Point | 200.4±25.0 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Decinnamoyltaxagifine |