| Chengdu Push Bio-technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (028) 8537-0506-229 | |||
![]() |
3004654993@qq.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18080489829 | |||
| Chemical manufacturer since 2005 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | 6'-Feruloylnodakenin |
|---|---|
| Synonyms | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-[(2R)-7-oxo-2,3-dihydrofuro[3,2-g]chromen-2-yl]propan-2-yloxy]oxan-2-yl]methyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| Molecular Structure | ![]() |
| Molecular Formula | C30H32O12 |
| Molecular Weight | 584.57 |
| CAS Registry Number | 131623-14-8 |
| SMILES | CC(C)([C@H]1CC2=C(O1)C=C3C(=C2)C=CC(=O)O3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)COC(=O)/C=C/C5=CC(=C(C=C5)O)OC)O)O)O |
| Density | 1.5±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.660, Calc.* |
| Boiling Point | 820.4±65.0 ºC (760 mmHg), Calc.* |
| Flash Point | 268.4±27.8 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 6'-Feruloylnodakenin |