| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Classification | Analytical chemistry >> Standard >> Pharmacopoeia standards and magazine standards |
|---|---|
| Name | Citalopram EP Impurity B Oxalate |
| Synonyms | 3-Hydroxy Citalopram Oxalate |
| Molecular Structure | ![]() |
| Molecular Formula | C22H23FN2O6 |
| Molecular Weight | 430.43 |
| CAS Registry Number | 1332724-03-4 |
| EC Number | 807-770-4 |
| SMILES | CN(C)CCCC1(C2=C(C=C(C=C2)C#N)C(O1)O)C3=CC=C(C=C3)F.C(=O)(C(=O)O)O |
| Hazard Symbols |
| ||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302+H312+H332-H315-H319 Details | ||||||||||||||||
| Precautionary Statements | P261-P271-P280-P302+P352-P305+P351+P338 Details | ||||||||||||||||
| Hazard Classification | |||||||||||||||||
| |||||||||||||||||
| SDS | Available | ||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for Citalopram EP Impurity B Oxalate |