| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | 2,8-Dichloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-one |
|---|---|
| Synonyms | 5,13-dichloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one |
| Molecular Structure | ![]() |
| Molecular Formula | C14H9Cl2NO |
| Molecular Weight | 278.13 |
| CAS Registry Number | 133330-61-7 |
| SMILES | C1CC2=C(C=CC(=C2)Cl)C(=O)C3=C1C=CC(=N3)Cl |
| Solubility | 3.272 mg/L (25 ºC water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.639, Calc.* |
| Melting point | 146.69 ºC |
| Boiling Point | 380.64 ºC, 468.8±45.0 ºC (760 mmHg), Calc.* |
| Flash Point | 237.3±28.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302+H312+H332-H315-H319 Details |
| Precautionary Statements | P261-P271-P280-P302+P352-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 2,8-Dichloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-one |