| Shanghai Worldyang Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13651600618 +86 (21) 5679-5779 | |||
![]() |
sales7777@worldyachem.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: 13651600618 | |||
![]() |
WhatsApp: +86 13651600618 | |||
| Chemical manufacturer since 2012 | ||||
| chemBlink premium supplier since 2023 | ||||
| Name | 2-(1-chlorocyclopropyl)-2-[(2-chlorophenyl)methyl]-Oxirane |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H12Cl2O |
| Molecular Weight | 243.13 |
| CAS Registry Number | 134818-68-1 |
| EC Number | 603-875-2 |
| SMILES | C1CC1(C2(CO2)CC3=CC=CC=C3Cl)Cl |
| Solubility | 6.807 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.600, Calc.* |
| Melting point | 83.18 ºC |
| Boiling Point | 292.76 ºC, 335.5±27.0 ºC (760 mmHg), Calc.* |
| Flash Point | 133.7±23.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H315-H317-H400-H410 Details | ||||||||||||||||||||||||
| Precautionary Statements | P261-P264-P272-P273-P280-P302+P352-P321-P332+P317-P333+P313-P362+P364-P391-P501 Details | ||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||
| |||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 2-(1-chlorocyclopropyl)-2-[(2-chlorophenyl)methyl]-Oxirane |