Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Analytical chemistry >> Standard >> Analytical standard |
|---|---|
| Name | Triclabendazole-D3 |
| Synonyms | 6-chloro-5-(2,3-dichlorophenoxy)-2-(trideuteriomethylsulfanyl)-1H-benzimidazole |
| Molecular Structure |  |
| Molecular Formula | C14H9Cl3N2OS |
| Molecular Weight | 362.68 |
| CAS Registry Number | 1353867-93-2 |
| SMILES | [2H]C([2H])([2H])SC1=NC2=CC(=C(C=C2N1)Cl)OC3=C(C(=CC=C3)Cl)Cl |
| Density | 1.6±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.724, Calc.* |
| Boiling Point | 495.9±55.0 ºC (760 mmHg), Calc.* |
| Flash Point | 253.7±31.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Triclabendazole-D3 |