| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Camalexin |
|---|---|
| Synonyms | 2-(1H-indol-3-yl)-1,3-thiazole |
| Molecular Structure | ![]() |
| Molecular Formula | C11H8N2S |
| Molecular Weight | 200.26 |
| CAS Registry Number | 135531-86-1 |
| EC Number | 808-542-7 |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C3=NC=CS3 |
| Solubility | 172.8 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.726, Calc.* |
| Melting point | 138.97 ºC |
| Boiling Point | 378.68 ºC, 424.8±47.0 ºC (760 mmHg), Calc.* |
| Flash Point | 211.5±19.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302-H315-H319-H335 Details | ||||||||||||||||||||||||
| Precautionary Statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P312-P321-P330-P332 Details | ||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||
| |||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for Camalexin |