| Wuhan Xiju Biotechnology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13043116031 | |||
![]() |
Fan@wh-xiju.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2021 | ||||
| chemBlink standard supplier since 2021 | ||||
| Name | 4-Fluoro-4-methylaminorex |
|---|---|
| Synonyms | 5-(4-fluorophenyl)-4-methyl-4,5-dihydro-1,3-oxazol-2-amine |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11FN2O |
| Molecular Weight | 194.21 |
| CAS Registry Number | 1364933-64-1 |
| SMILES | CC1C(OC(=N1)N)C2=CC=C(C=C2)F |
| Density | 1.3±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.592, Calc.* |
| Boiling Point | 293.6±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 131.4±30.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 4-Fluoro-4-methylaminorex |