| Yujiao Bio-chem Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 17060324263 | |||
![]() |
ficherchem@gmail.com | |||
| Chemical distributor since 2016 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | Methyl 10-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-9-methoxy-3-oxo-3H-benzo[f]chromene-2-carboxylate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C20H13NO7 |
| Molecular Weight | 379.32 |
| CAS Registry Number | 137350-66-4 |
| SMILES | COC1=C(C2=C(C=CC3=C2C=C(C(=O)O3)C(=O)OC)C=C1)N4C(=O)C=CC4=O |
| Solubility | 658.7 mg/L (25 ºC water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.682, Calc.* |
| Melting point | 278.78 ºC |
| Boiling Point | 641.68 ºC, 635.5±55.0 ºC (760 mmHg), Calc.* |
| Flash Point | 338.1±31.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H332-H335 Details |
| Precautionary Statements | P361-P280-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Methyl 10-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-9-methoxy-3-oxo-3H-benzo[f]chromene-2-carboxylate |