|
CAS: 1374248-77-7 Product: Ubrogepant No suppilers available. |
| Name | Ubrogepant |
|---|---|
| Synonyms | (3S)-N-[(3S,5S,6R)-6-methyl-2-oxo-5-phenyl-1-(2,2,2-trifluoroethyl)piperidin-3-yl]-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[b]pyridine]-3'-carboxamide |
| Molecular Structure | ![]() |
| Molecular Formula | C29H26F3N5O3 |
| Molecular Weight | 549.54 |
| CAS Registry Number | 1374248-77-7 |
| SMILES | C[C@@H]1[C@@H](C[C@@H](C(=O)N1CC(F)(F)F)NC(=O)C2=CC3=C(C[C@@]4(C3)C5=C(NC4=O)N=CC=C5)N=C2)C6=CC=CC=C6 |
| Density | 1.5±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.649, Calc.* |
| Boiling Point | 729.4±60.0 ºC (760 mmHg), Calc.* |
| Flash Point | 394.9±32.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Ubrogepant |